C25H26N2 — CID 144868863
4-ethyl-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N,15-dimethyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-3-amine (PubChem CID 144868863) has the molecular formula C25H26N2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-ethyl-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N,15-dimethyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-3-amine.
| Compound Name | 4-ethyl-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N,15-dimethyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-3-amine |
|---|---|
| PubChem CID | 144868863 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-ethyl-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N,15-dimethyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-3-amine |
| SMILES | C=C(/C=C\C=C/C)N(C)c1cc2c3c(ccc4cccc(c43)n2C)c1CC |
| InChI | InChI=1S/C25H26N2/c1-6-8-9-11-17(3)26(4)22-16-23-25-20(19(22)7-2)15-14-18-12-10-13-21(24(18)25)27(23)5/h6,8-16H,3,7H2,1-2,4-5H3/b8-6-,11-9- |
| InChIKey | YEPLSAPMHGVHQL-BBDSXROGSA-N |
| XLogP | 6.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|