C18H20N6O4S — CID 144870431
methyl 8-[(2-acetyloxyethanehydrazonoyl)-aminoamino]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 144870431) has the molecular formula C18H20N6O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is methyl 8-[(2-acetyloxyethanehydrazonoyl)-aminoamino]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | methyl 8-[(2-acetyloxyethanehydrazonoyl)-aminoamino]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 144870431 |
| Molecular Formula | C18H20N6O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | methyl 8-[(2-acetyloxyethanehydrazonoyl)-aminoamino]-3-(5-methylthiophen-2-yl)imidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc(N(N)/C(COC(C)=O)=N\N)c2ncc(-c3ccc(C)s3)n2c1 |
| InChI | InChI=1S/C18H20N6O4S/c1-10-4-5-15(29-10)14-7-21-17-13(6-12(8-23(14)17)18(26)27-3)24(20)16(22-19)9-28-11(2)25/h4-8H,9,19-20H2,1-3H3/b22-16- |
| InChIKey | YTKQRCYCNMMGSD-JWGURIENSA-N |
| XLogP | 1.67 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|