C16H18N4O3S — CID 144872049
tert-butyl 5-amino-3-[2-(hydroxyamino)-1,3-thiazol-5-yl]indole-1-carboxylate (PubChem CID 144872049) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is tert-butyl 5-amino-3-[2-(hydroxyamino)-1,3-thiazol-5-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-amino-3-[2-(hydroxyamino)-1,3-thiazol-5-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 144872049 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | tert-butyl 5-amino-3-[2-(hydroxyamino)-1,3-thiazol-5-yl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cnc(NO)s2)c2cc(N)ccc21 |
| InChI | InChI=1S/C16H18N4O3S/c1-16(2,3)23-15(21)20-8-11(13-7-18-14(19-22)24-13)10-6-9(17)4-5-12(10)20/h4-8,22H,17H2,1-3H3,(H,18,19) |
| InChIKey | JZFLVYUUQWWPPE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|