C14H17FN4O2 — CID 166904682
tert-butyl 2-amino-4-(4-amino-2-fluorophenyl)imidazole-1-carboxylate (PubChem CID 166904682) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is tert-butyl 2-amino-4-(4-amino-2-fluorophenyl)imidazole-1-carboxylate.
| Compound Name | tert-butyl 2-amino-4-(4-amino-2-fluorophenyl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 166904682 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | tert-butyl 2-amino-4-(4-amino-2-fluorophenyl)imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2ccc(N)cc2F)nc1N |
| InChI | InChI=1S/C14H17FN4O2/c1-14(2,3)21-13(20)19-7-11(18-12(19)17)9-5-4-8(16)6-10(9)15/h4-7H,16H2,1-3H3,(H2,17,18) |
| InChIKey | MAVMBVQLVSHKKG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|