C23H32N4O5 — CID 59334887
tert-butyl 6-amino-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]indole-1-carboxylate (PubChem CID 59334887) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl 6-amino-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]indole-1-carboxylate.
| Compound Name | tert-butyl 6-amino-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 59334887 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl 6-amino-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cn(C(=O)OC(C)(C)C)c3cc(N)ccc23)CC1 |
| InChI | InChI=1S/C23H32N4O5/c1-22(2,3)31-20(29)26-11-9-25(10-12-26)19(28)17-14-27(21(30)32-23(4,5)6)18-13-15(24)7-8-16(17)18/h7-8,13-14H,9-12,24H2,1-6H3 |
| InChIKey | XSTKUEOXIAJSCK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|