C34H43NO2 — CID 144872558
4-[9-[3-[(2E,4E)-3-cyclopropyl-6-methoxy-5-methylhexa-2,4-dien-2-yl]-4-methylphenyl]-9-oxononan-4-yl]benzonitrile (PubChem CID 144872558) has the molecular formula C34H43NO2 and a molecular weight of 497.72 g/mol. Its IUPAC name is 4-[9-[3-[(2E,4E)-3-cyclopropyl-6-methoxy-5-methylhexa-2,4-dien-2-yl]-4-methylphenyl]-9-oxononan-4-yl]benzonitrile.
| Compound Name | 4-[9-[3-[(2E,4E)-3-cyclopropyl-6-methoxy-5-methylhexa-2,4-dien-2-yl]-4-methylphenyl]-9-oxononan-4-yl]benzonitrile |
|---|---|
| PubChem CID | 144872558 |
| Molecular Formula | C34H43NO2 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 4-[9-[3-[(2E,4E)-3-cyclopropyl-6-methoxy-5-methylhexa-2,4-dien-2-yl]-4-methylphenyl]-9-oxononan-4-yl]benzonitrile |
| SMILES | CCCC(CCCCC(=O)c1ccc(C)c(/C(C)=C(/C=C(\C)COC)C2CC2)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C34H43NO2/c1-6-9-28(29-16-13-27(22-35)14-17-29)10-7-8-11-34(36)31-15-12-25(3)32(21-31)26(4)33(30-18-19-30)20-24(2)23-37-5/h12-17,20-21,28,30H,6-11,18-19,23H2,1-5H3/b24-20+,33-26- |
| InChIKey | RAYJKPPVBKEGCP-IYTLWPAOSA-N |
| XLogP | 8.97 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|