C24H29ClN4O — CID 144881124
N-[1-(2-amino-5-chlorophenyl)-1-iminopropan-2-yl]-5-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]pyridine-3-carboxamide (PubChem CID 144881124) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is N-[1-(2-amino-5-chlorophenyl)-1-iminopropan-2-yl]-5-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]pyridine-3-carboxamide.
| Compound Name | N-[1-(2-amino-5-chlorophenyl)-1-iminopropan-2-yl]-5-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144881124 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[1-(2-amino-5-chlorophenyl)-1-iminopropan-2-yl]-5-[(2E,4E)-2,5-dimethylhepta-2,4-dienyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C(/c1cc(Cl)ccc1N)C(C)NC(=O)c1cncc(C/C(C)=C/C=C(\C)CC)c1 |
| InChI | InChI=1S/C24H29ClN4O/c1-5-15(2)6-7-16(3)10-18-11-19(14-28-13-18)24(30)29-17(4)23(27)21-12-20(25)8-9-22(21)26/h6-9,11-14,17,27H,5,10,26H2,1-4H3,(H,29,30)/b15-6+,16-7+,27-23+ |
| InChIKey | VOJMDUMSNORFEX-SKBSIUSGSA-N |
| XLogP | 5.35 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|