C24H22ClF2N5O2 — CID 144881066
5-[[4-(acetamidomethyl)-2,3-difluorophenyl]methyl]-N-[2-(2-amino-5-chlorophenyl)-2-iminoethyl]pyridine-3-carboxamide (PubChem CID 144881066) has the molecular formula C24H22ClF2N5O2 and a molecular weight of 485.92 g/mol. Its IUPAC name is 5-[[4-(acetamidomethyl)-2,3-difluorophenyl]methyl]-N-[2-(2-amino-5-chlorophenyl)-2-iminoethyl]pyridine-3-carboxamide.
| Compound Name | 5-[[4-(acetamidomethyl)-2,3-difluorophenyl]methyl]-N-[2-(2-amino-5-chlorophenyl)-2-iminoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144881066 |
| Molecular Formula | C24H22ClF2N5O2 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 5-[[4-(acetamidomethyl)-2,3-difluorophenyl]methyl]-N-[2-(2-amino-5-chlorophenyl)-2-iminoethyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C(/CNC(=O)c1cncc(Cc2ccc(CNC(C)=O)c(F)c2F)c1)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C24H22ClF2N5O2/c1-13(33)31-11-16-3-2-15(22(26)23(16)27)6-14-7-17(10-30-9-14)24(34)32-12-21(29)19-8-18(25)4-5-20(19)28/h2-5,7-10,29H,6,11-12,28H2,1H3,(H,31,33)(H,32,34)/b29-21- |
| InChIKey | PXPXYCREKQBVJA-ANYBSYGZSA-N |
| XLogP | 3.62 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|