C33H39N5O3 — CID 144881308
acetaldehyde;5-[(2Z,4E)-2-ethenyl-5-methyl-6-(2-oxo-1-pyridinyl)hexa-2,4-dienyl]-N-[2-[2-(ethylamino)-5-methylphenyl]-2-iminoethyl]pyridine-3-carboxamide (PubChem CID 144881308) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is acetaldehyde;5-[(2Z,4E)-2-ethenyl-5-methyl-6-(2-oxo-1-pyridinyl)hexa-2,4-dienyl]-N-[2-[2-(ethylamino)-5-methylphenyl]-2-iminoethyl]pyridine-3-carboxamide.
| Compound Name | acetaldehyde;5-[(2Z,4E)-2-ethenyl-5-methyl-6-(2-oxo-1-pyridinyl)hexa-2,4-dienyl]-N-[2-[2-(ethylamino)-5-methylphenyl]-2-iminoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144881308 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | acetaldehyde;5-[(2Z,4E)-2-ethenyl-5-methyl-6-(2-oxo-1-pyridinyl)hexa-2,4-dienyl]-N-[2-[2-(ethylamino)-5-methylphenyl]-2-iminoethyl]pyridine-3-carboxamide |
| SMILES | CC=O.[H]/N=C(\CNC(=O)c1cncc(C/C(C=C)=C/C=C(\C)Cn2ccccc2=O)c1)c1cc(C)ccc1NCC |
| InChI | InChI=1S/C31H35N5O2.C2H4O/c1-5-24(12-10-23(4)21-36-14-8-7-9-30(36)37)16-25-17-26(19-33-18-25)31(38)35-20-28(32)27-15-22(3)11-13-29(27)34-6-2;1-2-3/h5,7-15,17-19,32,34H,1,6,16,20-21H2,2-4H3,(H,35,38);2H,1H3/b23-10+,24-12+,32-28+; |
| InChIKey | WLPHOAPCFYAQMA-XCTMPENASA-N |
| XLogP | 5.29 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|