C17H34N4O2 — CID 144881991
(Z)-2-amino-3-[amino-(4,4-dimethylcyclohexyl)amino]-1-morpholin-4-ylprop-2-en-1-one;ethane (PubChem CID 144881991) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-(4,4-dimethylcyclohexyl)amino]-1-morpholin-4-ylprop-2-en-1-one;ethane.
| Compound Name | (Z)-2-amino-3-[amino-(4,4-dimethylcyclohexyl)amino]-1-morpholin-4-ylprop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 144881991 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | (Z)-2-amino-3-[amino-(4,4-dimethylcyclohexyl)amino]-1-morpholin-4-ylprop-2-en-1-one;ethane |
| SMILES | CC.CC1(C)CCC(N(N)/C=C(\N)C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C15H28N4O2.C2H6/c1-15(2)5-3-12(4-6-15)19(17)11-13(16)14(20)18-7-9-21-10-8-18;1-2/h11-12H,3-10,16-17H2,1-2H3;1-2H3/b13-11-; |
| InChIKey | VARKLIKWRFENNW-KEHAOADBSA-N |
| XLogP | 1.82 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|