C15H23N3 — CID 144882762
N-[(E)-1-[4-(aminomethyl)-2-ethylphenyl]but-3-enylideneamino]ethanamine (PubChem CID 144882762) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-[(E)-1-[4-(aminomethyl)-2-ethylphenyl]but-3-enylideneamino]ethanamine.
| Compound Name | N-[(E)-1-[4-(aminomethyl)-2-ethylphenyl]but-3-enylideneamino]ethanamine |
|---|---|
| PubChem CID | 144882762 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-[(E)-1-[4-(aminomethyl)-2-ethylphenyl]but-3-enylideneamino]ethanamine |
| SMILES | C=CC/C(=N\NCC)c1ccc(CN)cc1CC |
| InChI | InChI=1S/C15H23N3/c1-4-7-15(18-17-6-3)14-9-8-12(11-16)10-13(14)5-2/h4,8-10,17H,1,5-7,11,16H2,2-3H3/b18-15+ |
| InChIKey | NNPIKUQZZSSIFF-OBGWFSINSA-N |
| XLogP | 2.60 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|