C13H15NO — CID 144884686
(E)-2-buta-1,3-dien-2-yloxy-1-phenylprop-1-en-1-amine (PubChem CID 144884686) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-2-buta-1,3-dien-2-yloxy-1-phenylprop-1-en-1-amine.
| Compound Name | (E)-2-buta-1,3-dien-2-yloxy-1-phenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 144884686 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (E)-2-buta-1,3-dien-2-yloxy-1-phenylprop-1-en-1-amine |
| SMILES | C=CC(=C)O/C(C)=C(/N)c1ccccc1 |
| InChI | InChI=1S/C13H15NO/c1-4-10(2)15-11(3)13(14)12-8-6-5-7-9-12/h4-9H,1-2,14H2,3H3/b13-11+ |
| InChIKey | LCXRGHGVAVJRIV-ACCUITESSA-N |
| XLogP | 3.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|