C24H33ClN5OP — CID 144887695
3-[1-(6-chloro-2-methyl-3-phosphanylphenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine;ethane (PubChem CID 144887695) has the molecular formula C24H33ClN5OP and a molecular weight of 473.99 g/mol. Its IUPAC name is 3-[1-(6-chloro-2-methyl-3-phosphanylphenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine;ethane.
| Compound Name | 3-[1-(6-chloro-2-methyl-3-phosphanylphenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 144887695 |
| Molecular Formula | C24H33ClN5OP |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-[1-(6-chloro-2-methyl-3-phosphanylphenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine;ethane |
| SMILES | CC.Cc1c(P)ccc(Cl)c1C(C)Oc1cc(-c2cnn(C3CCNCC3)c2)cnc1N |
| InChI | InChI=1S/C22H27ClN5OP.C2H6/c1-13-20(30)4-3-18(23)21(13)14(2)29-19-9-15(10-26-22(19)24)16-11-27-28(12-16)17-5-7-25-8-6-17;1-2/h3-4,9-12,14,17,25H,5-8,30H2,1-2H3,(H2,24,26);1-2H3 |
| InChIKey | GPNGDTAKBXUDEM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|