C8H9IN4 — CID 144888968
3-iodo-N,N-dimethylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 144888968) has the molecular formula C8H9IN4 and a molecular weight of 288.09 g/mol. Its IUPAC name is 3-iodo-N,N-dimethylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 3-iodo-N,N-dimethylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 144888968 |
| Molecular Formula | C8H9IN4 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-iodo-N,N-dimethylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CN(C)c1ccn2ncc(I)c2n1 |
| InChI | InChI=1S/C8H9IN4/c1-12(2)7-3-4-13-8(11-7)6(9)5-10-13/h3-5H,1-2H3 |
| InChIKey | ZCOPFFZQAAAUDK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|