C19H24ClN3O2 — CID 144891886
[1-(chloromethyl)-3-methyl-1,2-dihydrobenzo[e]indol-5-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate (PubChem CID 144891886) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is [1-(chloromethyl)-3-methyl-1,2-dihydrobenzo[e]indol-5-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate.
| Compound Name | [1-(chloromethyl)-3-methyl-1,2-dihydrobenzo[e]indol-5-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 144891886 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [1-(chloromethyl)-3-methyl-1,2-dihydrobenzo[e]indol-5-yl] N-methyl-N-[2-(methylamino)ethyl]carbamate |
| SMILES | CNCCN(C)C(=O)Oc1cc2c(c3ccccc13)C(CCl)CN2C |
| InChI | InChI=1S/C19H24ClN3O2/c1-21-8-9-22(2)19(24)25-17-10-16-18(13(11-20)12-23(16)3)15-7-5-4-6-14(15)17/h4-7,10,13,21H,8-9,11-12H2,1-3H3 |
| InChIKey | FRDCUQYOEWIWAS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|