C15H30B2O4 — CID 144892826
2-(4-butan-2-yl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 144892826) has the molecular formula C15H30B2O4 and a molecular weight of 296.03 g/mol. Its IUPAC name is 2-(4-butan-2-yl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-butan-2-yl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144892826 |
| Molecular Formula | C15H30B2O4 |
| Molecular Weight | 296.03 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 2-(4-butan-2-yl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC(C)C1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C15H30B2O4/c1-10-11(2)15(9)14(7,8)20-17(21-15)16-18-12(3,4)13(5,6)19-16/h11H,10H2,1-9H3 |
| InChIKey | PJZYQFWZTMFYLK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.03 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|