C17H40BNO2Si2 — CID 13491260
2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis(trimethylsilyl)butan-1-amine (PubChem CID 13491260) has the molecular formula C17H40BNO2Si2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis(trimethylsilyl)butan-1-amine.
| Compound Name | 2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis(trimethylsilyl)butan-1-amine |
|---|---|
| PubChem CID | 13491260 |
| Molecular Formula | C17H40BNO2Si2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,N-bis(trimethylsilyl)butan-1-amine |
| SMILES | CCC(C)C(B1OC(C)(C)C(C)(C)O1)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H40BNO2Si2/c1-13-14(2)15(19(22(7,8)9)23(10,11)12)18-20-16(3,4)17(5,6)21-18/h14-15H,13H2,1-12H3 |
| InChIKey | UVKNIXKYFIFYDE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|