C17H30BNO2 — CID 91490640
6-(3-methylpentan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine (PubChem CID 91490640) has the molecular formula C17H30BNO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is 6-(3-methylpentan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine.
| Compound Name | 6-(3-methylpentan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 91490640 |
| Molecular Formula | C17H30BNO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 6-(3-methylpentan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,5-dihydropyridine |
| SMILES | CCC(C)C(C)C1=NCC(B2OC(C)(C)C(C)(C)O2)=CC1 |
| InChI | InChI=1S/C17H30BNO2/c1-8-12(2)13(3)15-10-9-14(11-19-15)18-20-16(4,5)17(6,7)21-18/h9,12-13H,8,10-11H2,1-7H3 |
| InChIKey | WOAVMVWIKAKHQL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|