C14H13FN2O2S — CID 144893369
3-(6-fluoro-2-pyridinyl)-2-prop-1-en-2-ylbenzenesulfonamide (PubChem CID 144893369) has the molecular formula C14H13FN2O2S and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(6-fluoro-2-pyridinyl)-2-prop-1-en-2-ylbenzenesulfonamide.
| Compound Name | 3-(6-fluoro-2-pyridinyl)-2-prop-1-en-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 144893369 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-(6-fluoro-2-pyridinyl)-2-prop-1-en-2-ylbenzenesulfonamide |
| SMILES | C=C(C)c1c(-c2cccc(F)n2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H13FN2O2S/c1-9(2)14-10(11-6-4-8-13(15)17-11)5-3-7-12(14)20(16,18)19/h3-8H,1H2,2H3,(H2,16,18,19) |
| InChIKey | IPHKMFBPVVPJCR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|