C16H17ClFN3O2 — CID 144900876
2-[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyanilino]ethanimidamide (PubChem CID 144900876) has the molecular formula C16H17ClFN3O2 and a molecular weight of 337.78 g/mol. Its IUPAC name is 2-[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyanilino]ethanimidamide.
| Compound Name | 2-[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyanilino]ethanimidamide |
|---|---|
| PubChem CID | 144900876 |
| Molecular Formula | C16H17ClFN3O2 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyanilino]ethanimidamide |
| SMILES | [H]/N=C(\N)CNc1cccc(OC)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H17ClFN3O2/c1-22-14-4-2-3-13(21-8-15(19)20)16(14)23-9-10-5-6-11(18)7-12(10)17/h2-7,21H,8-9H2,1H3,(H3,19,20) |
| InChIKey | OEZZCPGRGJQJRK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|