C21H24N4 — CID 144901645
4-(1H-benzimidazol-2-ylamino)benzonitrile;methylcyclohexane (PubChem CID 144901645) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylamino)benzonitrile;methylcyclohexane.
| Compound Name | 4-(1H-benzimidazol-2-ylamino)benzonitrile;methylcyclohexane |
|---|---|
| PubChem CID | 144901645 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylamino)benzonitrile;methylcyclohexane |
| SMILES | CC1CCCCC1.N#Cc1ccc(Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H10N4.C7H14/c15-9-10-5-7-11(8-6-10)16-14-17-12-3-1-2-4-13(12)18-14;1-7-5-3-2-4-6-7/h1-8H,(H2,16,17,18);7H,2-6H2,1H3 |
| InChIKey | RYISLYSEYDFXOP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |