C20H19OP — CID 144905107
2-hydroxy-1,3-diphenyl-4,5,6,7-tetrahydroisophosphindole (PubChem CID 144905107) has the molecular formula C20H19OP and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-hydroxy-1,3-diphenyl-4,5,6,7-tetrahydroisophosphindole.
| Compound Name | 2-hydroxy-1,3-diphenyl-4,5,6,7-tetrahydroisophosphindole |
|---|---|
| PubChem CID | 144905107 |
| Molecular Formula | C20H19OP |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-hydroxy-1,3-diphenyl-4,5,6,7-tetrahydroisophosphindole |
| SMILES | Op1c(-c2ccccc2)c2c(c1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C20H19OP/c21-22-19(15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)16-11-5-2-6-12-16/h1-6,9-12,21H,7-8,13-14H2 |
| InChIKey | NPZMLXKCUJXXNX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |