About (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine
(E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine (PubChem CID 144905858) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine |
| PubChem CID | 144905858 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine |
| SMILES | CCOCC/C(N)=C(/C=O)NC.CNc1ccccn1 |
| InChI | InChI=1S/C8H16N2O2.C6H8N2/c1-3-12-5-4-7(9)8(6-11)10-2;1-7-6-4-2-3-5-8-6/h6,10H,3-5,9H2,1-2H3;2-5H,1H3,(H,7,8)/b8-7+; |
| InChIKey | UIRIUQRYIPVHHC-USRGLUTNSA-N |
| XLogP | 1.12 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine?
The IUPAC name of (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine (CID 144905858) is (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine.
What is the SMILES notation for (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine?
The canonical SMILES for (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine is CCOCC/C(N)=C(/C=O)NC.CNc1ccccn1.
What is the InChIKey of (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine?
The InChIKey is UIRIUQRYIPVHHC-USRGLUTNSA-N. The full InChI is InChI=1S/C8H16N2O2.C6H8N2/c1-3-12-5-4-7(9)8(6-11)10-2;1-7-6-4-2-3-5-8-6/h6,10H,3-5,9H2,1-2H3;2-5H,1H3,(H,7,8)/b8-7+;.
What are the key properties of (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine?
(E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine has a molecular weight of 280.37 g/mol, XLogP of 1.12, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-5-ethoxy-2-(methylamino)pent-2-enal;N-methylpyridin-2-amine is sourced from PubChem (CID 144905858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).