C9H16ClNO — CID 144906217
(2Z,4E)-5-chloro-2-methoxy-N-methylhepta-2,4-dien-3-amine (PubChem CID 144906217) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is (2Z,4E)-5-chloro-2-methoxy-N-methylhepta-2,4-dien-3-amine.
| Compound Name | (2Z,4E)-5-chloro-2-methoxy-N-methylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 144906217 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (2Z,4E)-5-chloro-2-methoxy-N-methylhepta-2,4-dien-3-amine |
| SMILES | CC/C(Cl)=C\C(NC)=C(/C)OC |
| InChI | InChI=1S/C9H16ClNO/c1-5-8(10)6-9(11-3)7(2)12-4/h6,11H,5H2,1-4H3/b8-6+,9-7- |
| InChIKey | FCNURTDZWAJMLM-FFELTBSMSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|