C8H14ClNO — CID 163754759
(2E,4Z)-5-chloro-2-methoxyhepta-2,4-dien-4-amine (PubChem CID 163754759) has the molecular formula C8H14ClNO and a molecular weight of 175.66 g/mol. Its IUPAC name is (2E,4Z)-5-chloro-2-methoxyhepta-2,4-dien-4-amine.
| Compound Name | (2E,4Z)-5-chloro-2-methoxyhepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 163754759 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2E,4Z)-5-chloro-2-methoxyhepta-2,4-dien-4-amine |
| SMILES | CC/C(Cl)=C(N)\C=C(/C)OC |
| InChI | InChI=1S/C8H14ClNO/c1-4-7(9)8(10)5-6(2)11-3/h5H,4,10H2,1-3H3/b6-5+,8-7- |
| InChIKey | LTCBCUBFFIRZRL-MDAAKZFYSA-N |
| XLogP | 2.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|