C21H35ClN2O3 — CID 144906238
(5E,7E)-7-chloro-5-ethyl-N-[(E)-7-hydroxy-3-(methylamino)-1-oxohept-2-en-2-yl]-3,3-dimethylnona-5,7-dienamide (PubChem CID 144906238) has the molecular formula C21H35ClN2O3 and a molecular weight of 398.98 g/mol. Its IUPAC name is (5E,7E)-7-chloro-5-ethyl-N-[(E)-7-hydroxy-3-(methylamino)-1-oxohept-2-en-2-yl]-3,3-dimethylnona-5,7-dienamide.
| Compound Name | (5E,7E)-7-chloro-5-ethyl-N-[(E)-7-hydroxy-3-(methylamino)-1-oxohept-2-en-2-yl]-3,3-dimethylnona-5,7-dienamide |
|---|---|
| PubChem CID | 144906238 |
| Molecular Formula | C21H35ClN2O3 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (5E,7E)-7-chloro-5-ethyl-N-[(E)-7-hydroxy-3-(methylamino)-1-oxohept-2-en-2-yl]-3,3-dimethylnona-5,7-dienamide |
| SMILES | C/C=C(Cl)\C=C(/CC)CC(C)(C)CC(=O)N/C(C=O)=C(\CCCCO)NC |
| InChI | InChI=1S/C21H35ClN2O3/c1-6-16(12-17(22)7-2)13-21(3,4)14-20(27)24-19(15-26)18(23-5)10-8-9-11-25/h7,12,15,23,25H,6,8-11,13-14H2,1-5H3,(H,24,27)/b16-12+,17-7+,19-18+ |
| InChIKey | VZPFGZJSEVUVEB-FUAKTYPASA-N |
| XLogP | 4.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|