C12H23N3O2 — CID 144906112
3,3-dimethyl-4-(methylamino)-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide (PubChem CID 144906112) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3,3-dimethyl-4-(methylamino)-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide.
| Compound Name | 3,3-dimethyl-4-(methylamino)-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide |
|---|---|
| PubChem CID | 144906112 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3,3-dimethyl-4-(methylamino)-N-[(E)-3-(methylamino)-1-oxobut-2-en-2-yl]butanamide |
| SMILES | CNCC(C)(C)CC(=O)N/C(C=O)=C(\C)NC |
| InChI | InChI=1S/C12H23N3O2/c1-9(14-5)10(7-16)15-11(17)6-12(2,3)8-13-4/h7,13-14H,6,8H2,1-5H3,(H,15,17)/b10-9+ |
| InChIKey | DLJSAMMKMNPQJJ-MDZDMXLPSA-N |
| XLogP | 0.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|