C24H27F3N5O9P — CID 144908609
N-[(E)-C-ethenyl-N-methoxycarbonimidoyl]-(morpholine-4-carbonyloxy)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid (PubChem CID 144908609) has the molecular formula C24H27F3N5O9P and a molecular weight of 617.47 g/mol. Its IUPAC name is N-[(E)-C-ethenyl-N-methoxycarbonimidoyl]-(morpholine-4-carbonyloxy)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid.
| Compound Name | N-[(E)-C-ethenyl-N-methoxycarbonimidoyl]-(morpholine-4-carbonyloxy)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid |
|---|---|
| PubChem CID | 144908609 |
| Molecular Formula | C24H27F3N5O9P |
| Molecular Weight | 617.47 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | N-[(E)-C-ethenyl-N-methoxycarbonimidoyl]-(morpholine-4-carbonyloxy)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid |
| SMILES | C=C/C(=N\OC)N(CC1CN(c2cc(F)c(N3C=CC(=O)CC3)c(F)c2F)C(=O)O1)P(=O)(O)OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H27F3N5O9P/c1-3-19(28-38-2)32(42(36,37)41-23(34)30-8-10-39-11-9-30)14-16-13-31(24(35)40-16)18-12-17(25)22(21(27)20(18)26)29-6-4-15(33)5-7-29/h3-4,6,12,16H,1,5,7-11,13-14H2,2H3,(H,36,37)/b28-19+ |
| InChIKey | QOJOWDQUUZHVIL-TURZUDJPSA-N |
| XLogP | 2.74 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|