C20H19F3N5O8P — CID 123679482
methylcarbamoyloxy-N-(1,2-oxazol-3-yl)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid (PubChem CID 123679482) has the molecular formula C20H19F3N5O8P and a molecular weight of 545.37 g/mol. Its IUPAC name is methylcarbamoyloxy-N-(1,2-oxazol-3-yl)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid.
| Compound Name | methylcarbamoyloxy-N-(1,2-oxazol-3-yl)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid |
|---|---|
| PubChem CID | 123679482 |
| Molecular Formula | C20H19F3N5O8P |
| Molecular Weight | 545.37 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | methylcarbamoyloxy-N-(1,2-oxazol-3-yl)-N-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]phosphonamidic acid |
| SMILES | CNC(=O)OP(=O)(O)N(CC1CN(c2cc(F)c(N3C=CC(=O)CC3)c(F)c2F)C(=O)O1)c1ccon1 |
| InChI | InChI=1S/C20H19F3N5O8P/c1-24-19(30)36-37(32,33)28(15-4-7-34-25-15)10-12-9-27(20(31)35-12)14-8-13(21)18(17(23)16(14)22)26-5-2-11(29)3-6-26/h2,4-5,7-8,12H,3,6,9-10H2,1H3,(H,24,30)(H,32,33) |
| InChIKey | ZIIRQBQDASMRPT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|