C13H10F3IN3O6P — CID 118336135
[1,2-oxazol-3-yl-[[(5R)-2-oxo-3-(2,3,5-trifluoro-4-iodophenyl)-1,3-oxazolidin-5-yl]methyl]amino]phosphonic acid (PubChem CID 118336135) has the molecular formula C13H10F3IN3O6P and a molecular weight of 519.11 g/mol. Its IUPAC name is [1,2-oxazol-3-yl-[[(5R)-2-oxo-3-(2,3,5-trifluoro-4-iodophenyl)-1,3-oxazolidin-5-yl]methyl]amino]phosphonic acid.
| Compound Name | [1,2-oxazol-3-yl-[[(5R)-2-oxo-3-(2,3,5-trifluoro-4-iodophenyl)-1,3-oxazolidin-5-yl]methyl]amino]phosphonic acid |
|---|---|
| PubChem CID | 118336135 |
| Molecular Formula | C13H10F3IN3O6P |
| Molecular Weight | 519.11 g/mol |
| Exact Mass | 518.93 |
| IUPAC Name | [1,2-oxazol-3-yl-[[(5R)-2-oxo-3-(2,3,5-trifluoro-4-iodophenyl)-1,3-oxazolidin-5-yl]methyl]amino]phosphonic acid |
| SMILES | O=C1O[C@@H](CN(c2ccon2)P(=O)(O)O)CN1c1cc(F)c(I)c(F)c1F |
| InChI | InChI=1S/C13H10F3IN3O6P/c14-7-3-8(10(15)11(16)12(7)17)19-4-6(26-13(19)21)5-20(27(22,23)24)9-1-2-25-18-9/h1-3,6H,4-5H2,(H2,22,23,24)/t6-/m1/s1 |
| InChIKey | YIRWCVPIAUBAFH-ZCFIWIBFSA-N |
| XLogP | 2.62 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|