C19H21F3N4O4 — CID 143760547
(Z)-3-hydroxy-N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]but-2-enimidamide;molecular hydrogen (PubChem CID 143760547) has the molecular formula C19H21F3N4O4 and a molecular weight of 426.40 g/mol. Its IUPAC name is (Z)-3-hydroxy-N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]but-2-enimidamide;molecular hydrogen.
| Compound Name | (Z)-3-hydroxy-N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]but-2-enimidamide;molecular hydrogen |
|---|---|
| PubChem CID | 143760547 |
| Molecular Formula | C19H21F3N4O4 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (Z)-3-hydroxy-N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]but-2-enimidamide;molecular hydrogen |
| SMILES | C/C(O)=C/C(N)=N/CC1CN(c2cc(F)c(N3C=CC(=O)CC3)c(F)c2F)C(=O)O1.[H][H] |
| InChI | InChI=1S/C19H19F3N4O4.H2/c1-10(27)6-15(23)24-8-12-9-26(19(29)30-12)14-7-13(20)18(17(22)16(14)21)25-4-2-11(28)3-5-25;/h2,4,6-7,12,27H,3,5,8-9H2,1H3,(H2,23,24);1H/b10-6-; |
| InChIKey | DEHXLYPEQNRCRI-OTUCAILMSA-N |
| XLogP | 2.79 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|