C17H17F3N4O4 — CID 163756480
methyl N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamimidate (PubChem CID 163756480) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is methyl N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamimidate.
| Compound Name | methyl N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamimidate |
|---|---|
| PubChem CID | 163756480 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | methyl N'-[[2-oxo-3-[2,3,5-trifluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]carbamimidate |
| SMILES | CO/C(N)=N\CC1CN(c2cc(F)c(N3C=CC(=O)CC3)c(F)c2F)C(=O)O1 |
| InChI | InChI=1S/C17H17F3N4O4/c1-27-16(21)22-7-10-8-24(17(26)28-10)12-6-11(18)15(14(20)13(12)19)23-4-2-9(25)3-5-23/h2,4,6,10H,3,5,7-8H2,1H3,(H2,21,22) |
| InChIKey | LUMJPTARAWZGRG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|