C10H12N2O2 — CID 144909396
1-ethyl-3,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile (PubChem CID 144909396) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-ethyl-3,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile.
| Compound Name | 1-ethyl-3,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 144909396 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-ethyl-3,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile |
| SMILES | CCN1C(=O)C(C#N)=C(C)C(C)C1=O |
| InChI | InChI=1S/C10H12N2O2/c1-4-12-9(13)7(3)6(2)8(5-11)10(12)14/h7H,4H2,1-3H3 |
| InChIKey | XBMRPVOLBFPSNA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|