C11H14FN3O3 — CID 144915274
methyl N-[2-[(2-ethyl-5-fluoro-3-pyridinyl)amino]-2-oxoethyl]carbamate (PubChem CID 144915274) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is methyl N-[2-[(2-ethyl-5-fluoro-3-pyridinyl)amino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[(2-ethyl-5-fluoro-3-pyridinyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 144915274 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl N-[2-[(2-ethyl-5-fluoro-3-pyridinyl)amino]-2-oxoethyl]carbamate |
| SMILES | CCc1ncc(F)cc1NC(=O)CNC(=O)OC |
| InChI | InChI=1S/C11H14FN3O3/c1-3-8-9(4-7(12)5-13-8)15-10(16)6-14-11(17)18-2/h4-5H,3,6H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | AKCABEFGBPKYTA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |