C19H38N2O — CID 144915416
but-1-ene;ethane;(3Z)-5-(morpholin-4-ylmethyl)hexa-1,3,5-trien-2-amine (PubChem CID 144915416) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is but-1-ene;ethane;(3Z)-5-(morpholin-4-ylmethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | but-1-ene;ethane;(3Z)-5-(morpholin-4-ylmethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144915416 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | but-1-ene;ethane;(3Z)-5-(morpholin-4-ylmethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C(=C)CN1CCOCC1.C=CCC.CC.CC |
| InChI | InChI=1S/C11H18N2O.C4H8.2C2H6/c1-10(3-4-11(2)12)9-13-5-7-14-8-6-13;1-3-4-2;2*1-2/h3-4H,1-2,5-9,12H2;3H,1,4H2,2H3;2*1-2H3/b4-3-;;; |
| InChIKey | RWRHMLVQIOXQLZ-FGSKAQBVSA-N |
| XLogP | 4.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|