C22H32N2OS2 — CID 144921825
N-ethylsulfanyl-2-[(3-methoxypropylamino)-(2-methyl-4-methylsulfanylphenyl)methyl]-N-methylaniline (PubChem CID 144921825) has the molecular formula C22H32N2OS2 and a molecular weight of 404.65 g/mol. Its IUPAC name is N-ethylsulfanyl-2-[(3-methoxypropylamino)-(2-methyl-4-methylsulfanylphenyl)methyl]-N-methylaniline.
| Compound Name | N-ethylsulfanyl-2-[(3-methoxypropylamino)-(2-methyl-4-methylsulfanylphenyl)methyl]-N-methylaniline |
|---|---|
| PubChem CID | 144921825 |
| Molecular Formula | C22H32N2OS2 |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-ethylsulfanyl-2-[(3-methoxypropylamino)-(2-methyl-4-methylsulfanylphenyl)methyl]-N-methylaniline |
| SMILES | CCSN(C)c1ccccc1C(NCCCOC)c1ccc(SC)cc1C |
| InChI | InChI=1S/C22H32N2OS2/c1-6-27-24(3)21-11-8-7-10-20(21)22(23-14-9-15-25-4)19-13-12-18(26-5)16-17(19)2/h7-8,10-13,16,22-23H,6,9,14-15H2,1-5H3 |
| InChIKey | FPTSQKHLBXRNHN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|