C15H19NOS2 — CID 163239844
2-[(3-methoxypropylamino)-thiophen-2-ylmethyl]benzenethiol (PubChem CID 163239844) has the molecular formula C15H19NOS2 and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-[(3-methoxypropylamino)-thiophen-2-ylmethyl]benzenethiol.
| Compound Name | 2-[(3-methoxypropylamino)-thiophen-2-ylmethyl]benzenethiol |
|---|---|
| PubChem CID | 163239844 |
| Molecular Formula | C15H19NOS2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[(3-methoxypropylamino)-thiophen-2-ylmethyl]benzenethiol |
| SMILES | COCCCNC(c1cccs1)c1ccccc1S |
| InChI | InChI=1S/C15H19NOS2/c1-17-10-5-9-16-15(14-8-4-11-19-14)12-6-2-3-7-13(12)18/h2-4,6-8,11,15-16,18H,5,9-10H2,1H3 |
| InChIKey | GKVDSEGLEJOTMQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|