C18H23ClN2OS — CID 118374502
5-chloro-2-[(3-methoxypropylamino)-[2-(methylamino)phenyl]methyl]benzenethiol (PubChem CID 118374502) has the molecular formula C18H23ClN2OS and a molecular weight of 350.92 g/mol. Its IUPAC name is 5-chloro-2-[(3-methoxypropylamino)-[2-(methylamino)phenyl]methyl]benzenethiol.
| Compound Name | 5-chloro-2-[(3-methoxypropylamino)-[2-(methylamino)phenyl]methyl]benzenethiol |
|---|---|
| PubChem CID | 118374502 |
| Molecular Formula | C18H23ClN2OS |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 5-chloro-2-[(3-methoxypropylamino)-[2-(methylamino)phenyl]methyl]benzenethiol |
| SMILES | CNc1ccccc1C(NCCCOC)c1ccc(Cl)cc1S |
| InChI | InChI=1S/C18H23ClN2OS/c1-20-16-7-4-3-6-14(16)18(21-10-5-11-22-2)15-9-8-13(19)12-17(15)23/h3-4,6-9,12,18,20-21,23H,5,10-11H2,1-2H3 |
| InChIKey | ZIPFQAMXLSYYFV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|