C23H31N3O6 — CID 144934309
diethyl 2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidin-2-yl]methyl]propanedioate (PubChem CID 144934309) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is diethyl 2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidin-2-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidin-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 144934309 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | diethyl 2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidin-2-yl]methyl]propanedioate |
| SMILES | C=C/C=C(\C=C)c1nc(CC(C(=O)OCC)C(=O)OCC)ncc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31N3O6/c1-8-12-15(9-2)19-17(25-22(29)32-23(5,6)7)14-24-18(26-19)13-16(20(27)30-10-3)21(28)31-11-4/h8-9,12,14,16H,1-2,10-11,13H2,3-7H3,(H,25,29)/b15-12+ |
| InChIKey | AZMKWSFSLFKGDE-NTCAYCPXSA-N |
| XLogP | 3.86 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|