C13H12FN3O3 — CID 144934907
7-[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 144934907) has the molecular formula C13H12FN3O3 and a molecular weight of 277.25 g/mol. Its IUPAC name is 7-[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 144934907 |
| Molecular Formula | C13H12FN3O3 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 7-[5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | C#CC1(CO)CCC(n2cc(F)c3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C13H12FN3O3/c1-2-13(6-18)4-3-9(20-13)17-5-8(14)10-11(17)15-7-16-12(10)19/h1,5,7,9,18H,3-4,6H2,(H,15,16,19) |
| InChIKey | RMJWXMWJNORKLT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|