C20H21O8P — CID 144935289
[6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxyphosphinous acid (PubChem CID 144935289) has the molecular formula C20H21O8P and a molecular weight of 420.35 g/mol. Its IUPAC name is [6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxyphosphinous acid.
| Compound Name | [6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxyphosphinous acid |
|---|---|
| PubChem CID | 144935289 |
| Molecular Formula | C20H21O8P |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [6-methoxy-2-methyl-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-7-yl]oxyphosphinous acid |
| SMILES | COc1cc(C(=O)c2c(C)oc3c(OPO)c(OC)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C20H21O8P/c1-10-16(12-6-7-13(23-2)20(28-29-22)18(12)27-10)17(21)11-8-14(24-3)19(26-5)15(9-11)25-4/h6-9,22,29H,1-5H3 |
| InChIKey | QGEFDXJOFRDNCW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|