C23H26N2O9 — CID 59138496
methyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate (PubChem CID 59138496) has the molecular formula C23H26N2O9 and a molecular weight of 474.47 g/mol. Its IUPAC name is methyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 59138496 |
| Molecular Formula | C23H26N2O9 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | methyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNc1oc2c(O)c(OC)ccc2c1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O9/c1-29-14-7-6-13-17(18(26)12-10-15(30-2)21(32-4)16(11-12)31-3)22(34-20(13)19(14)27)24-8-9-25-23(28)33-5/h6-7,10-11,24,27H,8-9H2,1-5H3,(H,25,28) |
| InChIKey | BNFFFEPSZKFCQS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|