C26H32N2O9 — CID 59138486
tert-butyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate (PubChem CID 59138486) has the molecular formula C26H32N2O9 and a molecular weight of 516.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 59138486 |
| Molecular Formula | C26H32N2O9 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | tert-butyl N-[2-[[7-hydroxy-6-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzofuran-2-yl]amino]ethyl]carbamate |
| SMILES | COc1cc(C(=O)c2c(NCCNC(=O)OC(C)(C)C)oc3c(O)c(OC)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N2O9/c1-26(2,3)37-25(31)28-11-10-27-24-19(15-8-9-16(32-4)21(30)22(15)36-24)20(29)14-12-17(33-5)23(35-7)18(13-14)34-6/h8-9,12-13,27,30H,10-11H2,1-7H3,(H,28,31) |
| InChIKey | QCLDVRGOALYBJM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|