C32H37N5O6S — CID 144937771
2-[3-amino-4-[3-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylcarbamoylamino]phenyl]prop-2-ynimidoyl]phenyl]sulfanylbenzamide (PubChem CID 144937771) has the molecular formula C32H37N5O6S and a molecular weight of 619.74 g/mol. Its IUPAC name is 2-[3-amino-4-[3-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylcarbamoylamino]phenyl]prop-2-ynimidoyl]phenyl]sulfanylbenzamide.
| Compound Name | 2-[3-amino-4-[3-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylcarbamoylamino]phenyl]prop-2-ynimidoyl]phenyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 144937771 |
| Molecular Formula | C32H37N5O6S |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 2-[3-amino-4-[3-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylcarbamoylamino]phenyl]prop-2-ynimidoyl]phenyl]sulfanylbenzamide |
| SMILES | [H]/N=C(\C#Cc1cccc(NC(=O)NCCOCCOCCOCCOC)c1)c1ccc(Sc2ccccc2C(N)=O)cc1N |
| InChI | InChI=1S/C32H37N5O6S/c1-40-15-16-42-19-20-43-18-17-41-14-13-36-32(39)37-24-6-4-5-23(21-24)9-12-28(33)26-11-10-25(22-29(26)34)44-30-8-3-2-7-27(30)31(35)38/h2-8,10-11,21-22,33H,13-20,34H2,1H3,(H2,35,38)(H2,36,37,39)/b33-28+ |
| InChIKey | UZAZUPDFARXQDT-PJJLUWSFSA-N |
| XLogP | 3.76 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|