C29H28N4O5S — CID 126760820
2-(2-methoxyethoxy)ethyl N-[3-[2-[6-[2-(methylcarbamoyl)phenyl]sulfanyl-2H-indazol-3-yl]ethynyl]phenyl]carbamate (PubChem CID 126760820) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-[3-[2-[6-[2-(methylcarbamoyl)phenyl]sulfanyl-2H-indazol-3-yl]ethynyl]phenyl]carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-[3-[2-[6-[2-(methylcarbamoyl)phenyl]sulfanyl-2H-indazol-3-yl]ethynyl]phenyl]carbamate |
|---|---|
| PubChem CID | 126760820 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-[3-[2-[6-[2-(methylcarbamoyl)phenyl]sulfanyl-2H-indazol-3-yl]ethynyl]phenyl]carbamate |
| SMILES | CNC(=O)c1ccccc1Sc1ccc2c(C#Cc3cccc(NC(=O)OCCOCCOC)c3)[nH]nc2c1 |
| InChI | InChI=1S/C29H28N4O5S/c1-30-28(34)24-8-3-4-9-27(24)39-22-11-12-23-25(32-33-26(23)19-22)13-10-20-6-5-7-21(18-20)31-29(35)38-17-16-37-15-14-36-2/h3-9,11-12,18-19H,14-17H2,1-2H3,(H,30,34)(H,31,35)(H,32,33) |
| InChIKey | ULHLRHHZSFXJPI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|