C34H40N6O7S — CID 126503670
2-[[3-[2-[5-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]-3-pyridinyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide (PubChem CID 126503670) has the molecular formula C34H40N6O7S and a molecular weight of 676.80 g/mol. Its IUPAC name is 2-[[3-[2-[5-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]-3-pyridinyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide.
| Compound Name | 2-[[3-[2-[5-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]-3-pyridinyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 126503670 |
| Molecular Formula | C34H40N6O7S |
| Molecular Weight | 676.80 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | 2-[[3-[2-[5-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethylcarbamoylamino]-3-pyridinyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Sc1ccc2c(C#Cc3cncc(NC(=O)NCCOCCOCCOCCOCCOC)c3)[nH]nc2c1 |
| InChI | InChI=1S/C34H40N6O7S/c1-35-33(41)29-5-3-4-6-32(29)48-27-8-9-28-30(39-40-31(28)22-27)10-7-25-21-26(24-36-23-25)38-34(42)37-11-12-44-15-16-46-19-20-47-18-17-45-14-13-43-2/h3-6,8-9,21-24H,11-20H2,1-2H3,(H,35,41)(H,39,40)(H2,37,38,42) |
| InChIKey | PLMWFMWZIOXTFY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 157.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|