C36H40N4O5S — CID 161179671
N-methyl-2-[[1-[2-[4-[4-[2-(2-morpholin-4-ylethoxy)ethoxy]butanoylamino]phenyl]ethynyl]-3H-isoindol-5-yl]sulfanyl]benzamide (PubChem CID 161179671) has the molecular formula C36H40N4O5S and a molecular weight of 640.81 g/mol. Its IUPAC name is N-methyl-2-[[1-[2-[4-[4-[2-(2-morpholin-4-ylethoxy)ethoxy]butanoylamino]phenyl]ethynyl]-3H-isoindol-5-yl]sulfanyl]benzamide.
| Compound Name | N-methyl-2-[[1-[2-[4-[4-[2-(2-morpholin-4-ylethoxy)ethoxy]butanoylamino]phenyl]ethynyl]-3H-isoindol-5-yl]sulfanyl]benzamide |
|---|---|
| PubChem CID | 161179671 |
| Molecular Formula | C36H40N4O5S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | N-methyl-2-[[1-[2-[4-[4-[2-(2-morpholin-4-ylethoxy)ethoxy]butanoylamino]phenyl]ethynyl]-3H-isoindol-5-yl]sulfanyl]benzamide |
| SMILES | CNC(=O)c1ccccc1Sc1ccc2c(c1)CN=C2C#Cc1ccc(NC(=O)CCCOCCOCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C36H40N4O5S/c1-37-36(42)32-5-2-3-6-34(32)46-30-13-14-31-28(25-30)26-38-33(31)15-10-27-8-11-29(12-9-27)39-35(41)7-4-19-43-23-24-45-22-18-40-16-20-44-21-17-40/h2-3,5-6,8-9,11-14,25H,4,7,16-24,26H2,1H3,(H,37,42)(H,39,41) |
| InChIKey | USGWVBXKRMSOEH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|