C16H20N2 — CID 144942988
(1Z,3Z)-1-[2-[[(Z)-but-2-enylidene]amino]phenyl]hexa-1,3-dien-1-amine (PubChem CID 144942988) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (1Z,3Z)-1-[2-[[(Z)-but-2-enylidene]amino]phenyl]hexa-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-1-[2-[[(Z)-but-2-enylidene]amino]phenyl]hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144942988 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (1Z,3Z)-1-[2-[[(Z)-but-2-enylidene]amino]phenyl]hexa-1,3-dien-1-amine |
| SMILES | C/C=C\C=N\c1ccccc1/C(N)=C/C=C\CC |
| InChI | InChI=1S/C16H20N2/c1-3-5-7-11-15(17)14-10-8-9-12-16(14)18-13-6-4-2/h4-13H,3,17H2,1-2H3/b6-4-,7-5-,15-11-,18-13+ |
| InChIKey | YFQTYQPVZQFANU-ZOAPHIAASA-N |
| XLogP | 4.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|