C11H12N2O — CID 145041061
2-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzaldehyde (PubChem CID 145041061) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzaldehyde.
| Compound Name | 2-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzaldehyde |
|---|---|
| PubChem CID | 145041061 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzaldehyde |
| SMILES | N/C=C\C=C(/N)c1ccccc1C=O |
| InChI | InChI=1S/C11H12N2O/c12-7-3-6-11(13)10-5-2-1-4-9(10)8-14/h1-8H,12-13H2/b7-3-,11-6- |
| InChIKey | YYSIKGVRXJXTIK-RPMIIJNOSA-N |
| XLogP | 1.27 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|