C21H23F3N2O — CID 144945286
ethane;1-(oxolan-3-yl)-2-[4-(trifluoromethyl)phenyl]indol-5-amine (PubChem CID 144945286) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is ethane;1-(oxolan-3-yl)-2-[4-(trifluoromethyl)phenyl]indol-5-amine.
| Compound Name | ethane;1-(oxolan-3-yl)-2-[4-(trifluoromethyl)phenyl]indol-5-amine |
|---|---|
| PubChem CID | 144945286 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethane;1-(oxolan-3-yl)-2-[4-(trifluoromethyl)phenyl]indol-5-amine |
| SMILES | CC.Nc1ccc2c(c1)cc(-c1ccc(C(F)(F)F)cc1)n2C1CCOC1 |
| InChI | InChI=1S/C19H17F3N2O.C2H6/c20-19(21,22)14-3-1-12(2-4-14)18-10-13-9-15(23)5-6-17(13)24(18)16-7-8-25-11-16;1-2/h1-6,9-10,16H,7-8,11,23H2;1-2H3 |
| InChIKey | XMEDQJUORFITLX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|